C20H16N2O5 — CID 164714424
2,3-bis[(3-nitrophenyl)methylidene]cyclohexan-1-one (PubChem CID 164714424) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2,3-bis[(3-nitrophenyl)methylidene]cyclohexan-1-one.
| Compound Name | 2,3-bis[(3-nitrophenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 164714424 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2,3-bis[(3-nitrophenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1CCCC(=Cc2cccc([N+](=O)[O-])c2)C1=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N2O5/c23-20-9-3-6-16(10-14-4-1-7-17(11-14)21(24)25)19(20)13-15-5-2-8-18(12-15)22(26)27/h1-2,4-5,7-8,10-13H,3,6,9H2 |
| InChIKey | AYAIKJKLKJHODI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|