C20H20ClN2O3+ — CID 2345209
[(1S,3Z)-1-(2-chlorophenyl)-3-[(3-nitrophenyl)methylidene]-2-oxocyclohexyl]-methylazanium (PubChem CID 2345209) has the molecular formula C20H20ClN2O3+ and a molecular weight of 371.84 g/mol. Its IUPAC name is [(1S,3Z)-1-(2-chlorophenyl)-3-[(3-nitrophenyl)methylidene]-2-oxocyclohexyl]-methylazanium.
| Compound Name | [(1S,3Z)-1-(2-chlorophenyl)-3-[(3-nitrophenyl)methylidene]-2-oxocyclohexyl]-methylazanium |
|---|---|
| PubChem CID | 2345209 |
| Molecular Formula | C20H20ClN2O3+ |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(1S,3Z)-1-(2-chlorophenyl)-3-[(3-nitrophenyl)methylidene]-2-oxocyclohexyl]-methylazanium |
| SMILES | C[NH2+][C@]1(c2ccccc2Cl)CCC/C(=C/c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-22-20(17-9-2-3-10-18(17)21)11-5-7-15(19(20)24)12-14-6-4-8-16(13-14)23(25)26/h2-4,6,8-10,12-13,22H,5,7,11H2,1H3/p+1/b15-12-/t20-/m0/s1 |
| InChIKey | QHMVVJXZEDDZMN-LFDGNKEFSA-O |
| XLogP | 3.47 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|