C13H8Cl2N2O2 — CID 927284
N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)methanimine (PubChem CID 927284) has the molecular formula C13H8Cl2N2O2 and a molecular weight of 295.13 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)methanimine.
| Compound Name | N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 927284 |
| Molecular Formula | C13H8Cl2N2O2 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O2/c14-11-5-2-6-12(15)13(11)16-8-9-3-1-4-10(7-9)17(18)19/h1-8H/b16-8+ |
| InChIKey | DJMJFUIVXPTUHR-LZYBPNLTSA-N |
| XLogP | 4.65 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|