C14H11Cl2N3O2 — CID 19060054
1-(2,6-dichlorophenyl)-N-[(E)-(3-nitrophenyl)methylideneamino]methanamine (PubChem CID 19060054) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-(3-nitrophenyl)methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-(3-nitrophenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 19060054 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-(3-nitrophenyl)methylideneamino]methanamine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/NCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-13-5-2-6-14(16)12(13)9-18-17-8-10-3-1-4-11(7-10)19(20)21/h1-8,18H,9H2/b17-8+ |
| InChIKey | XEWSUOFDVAVDJO-CAOOACKPSA-N |
| XLogP | 4.03 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|