C13H8Cl3N3O4S — CID 1378511
2,4,5-trichloro-N-[(3-nitrophenyl)methylideneamino]benzenesulfonamide (PubChem CID 1378511) has the molecular formula C13H8Cl3N3O4S and a molecular weight of 408.65 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(3-nitrophenyl)methylideneamino]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[(3-nitrophenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1378511 |
| Molecular Formula | C13H8Cl3N3O4S |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 2,4,5-trichloro-N-[(3-nitrophenyl)methylideneamino]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(C=NNS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl3N3O4S/c14-10-5-12(16)13(6-11(10)15)24(22,23)18-17-7-8-2-1-3-9(4-8)19(20)21/h1-7,18H |
| InChIKey | KICWOPKALKLLAT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|