C18H18Cl2N4O3 — CID 19060190
1-(2,6-dichlorophenyl)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]methanamine (PubChem CID 19060190) has the molecular formula C18H18Cl2N4O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 19060190 |
| Molecular Formula | C18H18Cl2N4O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]methanamine |
| SMILES | O=[N+]([O-])c1ccc(N2CCOCC2)c(/C=N/NCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N4O3/c19-16-2-1-3-17(20)15(16)12-22-21-11-13-10-14(24(25)26)4-5-18(13)23-6-8-27-9-7-23/h1-5,10-11,22H,6-9,12H2/b21-11+ |
| InChIKey | PRJNAPVOYACUCD-SRZZPIQSSA-N |
| XLogP | 3.86 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|