C20H21ClN4O4S — CID 94837847
(2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide (PubChem CID 94837847) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 94837847 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
| SMILES | C[C@@H](Sc1ccc(Cl)cc1)C(=O)N/N=C\c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H21ClN4O4S/c1-14(30-18-5-2-16(21)3-6-18)20(26)23-22-13-15-12-17(25(27)28)4-7-19(15)24-8-10-29-11-9-24/h2-7,12-14H,8-11H2,1H3,(H,23,26)/b22-13-/t14-/m1/s1 |
| InChIKey | HYUCQEUMXRNCQN-BXSODOALSA-N |
| XLogP | 3.72 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|