C23H26ClN5O4 — CID 4223106
2-chloro-N-[3-methyl-1-[2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 4223106) has the molecular formula C23H26ClN5O4 and a molecular weight of 471.95 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 4223106 |
| Molecular Formula | C23H26ClN5O4 |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)NN=Cc1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C23H26ClN5O4/c1-15(2)21(26-22(30)18-7-3-4-8-19(18)24)23(31)27-25-14-16-13-17(29(32)33)9-10-20(16)28-11-5-6-12-28/h3-4,7-10,13-15,21H,5-6,11-12H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | RHVZQNCPPXPGPQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|