C22H27N5O7S — CID 92661296
(2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide (PubChem CID 92661296) has the molecular formula C22H27N5O7S and a molecular weight of 505.55 g/mol. Its IUPAC name is (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 92661296 |
| Molecular Formula | C22H27N5O7S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(N([C@@H](C)C(=O)N/N=C\c2cc([N+](=O)[O-])ccc2N2CCOCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H27N5O7S/c1-16(26(35(3,31)32)18-4-7-20(33-2)8-5-18)22(28)24-23-15-17-14-19(27(29)30)6-9-21(17)25-10-12-34-13-11-25/h4-9,14-16H,10-13H2,1-3H3,(H,24,28)/b23-15-/t16-/m0/s1 |
| InChIKey | UMLLIFWOPKZMDP-VBHMAFOESA-N |
| XLogP | 1.74 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|