C21H25N5O6S — CID 92660635
2-(3-methyl-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 92660635) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-(3-methyl-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-methyl-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92660635 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-(3-methyl-N-methylsulfonylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cccc(N(CC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2N2CCOCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H25N5O6S/c1-16-4-3-5-18(12-16)25(33(2,30)31)15-21(27)23-22-14-17-13-19(26(28)29)6-7-20(17)24-8-10-32-11-9-24/h3-7,12-14H,8-11,15H2,1-2H3,(H,23,27)/b22-14- |
| InChIKey | BIKSPUKMQMGJMG-HMAPJEAMSA-N |
| XLogP | 1.66 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|