C29H33N5O8S — CID 98093667
2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 98093667) has the molecular formula C29H33N5O8S and a molecular weight of 611.68 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98093667 |
| Molecular Formula | C29H33N5O8S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2N2CCOCC2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C29H33N5O8S/c1-20-13-21(2)15-24(14-20)33(43(38,39)25-6-8-27(40-3)28(17-25)41-4)19-29(35)31-30-18-22-16-23(34(36)37)5-7-26(22)32-9-11-42-12-10-32/h5-8,13-18H,9-12,19H2,1-4H3,(H,31,35)/b30-18- |
| InChIKey | PSFMHGRWOSXWDX-YKQZZPSBSA-N |
| XLogP | 3.41 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|