C27H29N5O6S — CID 3775043
2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 3775043) has the molecular formula C27H29N5O6S and a molecular weight of 551.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3775043 |
| Molecular Formula | C27H29N5O6S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NN=Cc2cc([N+](=O)[O-])ccc2N2CCOCC2)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H29N5O6S/c1-20-8-10-25(21(2)16-20)31(39(36,37)24-6-4-3-5-7-24)19-27(33)29-28-18-22-17-23(32(34)35)9-11-26(22)30-12-14-38-15-13-30/h3-11,16-18H,12-15,19H2,1-2H3,(H,29,33) |
| InChIKey | MNJOVQYEQCDIFN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|