C25H24BrN5O6S — CID 98114804
2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 98114804) has the molecular formula C25H24BrN5O6S and a molecular weight of 602.47 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98114804 |
| Molecular Formula | C25H24BrN5O6S |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Br)cc1)S(=O)(=O)c1ccccc1)N/N=C\c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H24BrN5O6S/c26-20-6-8-21(9-7-20)30(38(35,36)23-4-2-1-3-5-23)18-25(32)28-27-17-19-16-22(31(33)34)10-11-24(19)29-12-14-37-15-13-29/h1-11,16-17H,12-15,18H2,(H,28,32)/b27-17- |
| InChIKey | WGGMXIIMRYCDDV-PKAZHMFMSA-N |
| XLogP | 3.54 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|