C20H21Cl2N5O6S — CID 43880023
2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 43880023) has the molecular formula C20H21Cl2N5O6S and a molecular weight of 530.39 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43880023 |
| Molecular Formula | C20H21Cl2N5O6S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C/c1cc([N+](=O)[O-])ccc1N1CCOCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N5O6S/c1-34(31,32)26(15-2-4-17(21)18(22)11-15)13-20(28)24-23-12-14-10-16(27(29)30)3-5-19(14)25-6-8-33-9-7-25/h2-5,10-12H,6-9,13H2,1H3,(H,24,28)/b23-12+ |
| InChIKey | HHCURHQHOASQET-FSJBWODESA-N |
| XLogP | 2.65 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|