C26H27N5O6S — CID 124539855
4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]benzamide (PubChem CID 124539855) has the molecular formula C26H27N5O6S and a molecular weight of 537.60 g/mol. Its IUPAC name is 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 124539855 |
| Molecular Formula | C26H27N5O6S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 4-[benzyl(methylsulfonyl)amino]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1ccc(C(=O)N/N=C\c2cc([N+](=O)[O-])ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H27N5O6S/c1-38(35,36)30(19-20-5-3-2-4-6-20)23-9-7-21(8-10-23)26(32)28-27-18-22-17-24(31(33)34)11-12-25(22)29-13-15-37-16-14-29/h2-12,17-18H,13-16,19H2,1H3,(H,28,32)/b27-18- |
| InChIKey | DCXZXFSDOYTAJW-IMRQLAEWSA-N |
| XLogP | 3.16 |
| TPSA | 134.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|