C22H18Cl2N4O5S — CID 126189353
N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide (PubChem CID 126189353) has the molecular formula C22H18Cl2N4O5S and a molecular weight of 521.38 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide.
| Compound Name | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide |
|---|---|
| PubChem CID | 126189353 |
| Molecular Formula | C22H18Cl2N4O5S |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)N/N=C\c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2N4O5S/c1-34(32,33)27(14-15-2-6-18(23)7-3-15)19-8-4-16(5-9-19)22(29)26-25-13-17-12-20(28(30)31)10-11-21(17)24/h2-13H,14H2,1H3,(H,26,29)/b25-13- |
| InChIKey | ADRRCYDTFQYQGJ-MXAYSNPKSA-N |
| XLogP | 4.63 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|