C27H29N5O7S — CID 126033340
(2R)-2-(N-methylsulfonyl-4-phenoxyanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide (PubChem CID 126033340) has the molecular formula C27H29N5O7S and a molecular weight of 567.62 g/mol. Its IUPAC name is (2R)-2-(N-methylsulfonyl-4-phenoxyanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-(N-methylsulfonyl-4-phenoxyanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 126033340 |
| Molecular Formula | C27H29N5O7S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (2R)-2-(N-methylsulfonyl-4-phenoxyanilino)-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]propanamide |
| SMILES | C[C@H](C(=O)N/N=C\c1cc([N+](=O)[O-])ccc1N1CCOCC1)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C27H29N5O7S/c1-20(31(40(2,36)37)22-8-11-25(12-9-22)39-24-6-4-3-5-7-24)27(33)29-28-19-21-18-23(32(34)35)10-13-26(21)30-14-16-38-17-15-30/h3-13,18-20H,14-17H2,1-2H3,(H,29,33)/b28-19-/t20-/m1/s1 |
| InChIKey | BGJZLWXMKISBTD-IMOINDBUSA-N |
| XLogP | 3.53 |
| TPSA | 143.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|