C24H22F3N3O4S — CID 3783564
2-(N-methylsulfonyl-4-phenoxyanilino)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]propanamide (PubChem CID 3783564) has the molecular formula C24H22F3N3O4S and a molecular weight of 505.52 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-4-phenoxyanilino)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]propanamide.
| Compound Name | 2-(N-methylsulfonyl-4-phenoxyanilino)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 3783564 |
| Molecular Formula | C24H22F3N3O4S |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 2-(N-methylsulfonyl-4-phenoxyanilino)-N-[[2-(trifluoromethyl)phenyl]methylideneamino]propanamide |
| SMILES | CC(C(=O)NN=Cc1ccccc1C(F)(F)F)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H22F3N3O4S/c1-17(23(31)29-28-16-18-8-6-7-11-22(18)24(25,26)27)30(35(2,32)33)19-12-14-21(15-13-19)34-20-9-4-3-5-10-20/h3-17H,1-2H3,(H,29,31) |
| InChIKey | WYFCNYZSWQUWMG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|