C22H22BrN3O5S — CID 126033327
(2R)-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126033327) has the molecular formula C22H22BrN3O5S and a molecular weight of 520.41 g/mol. Its IUPAC name is (2R)-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126033327 |
| Molecular Formula | C22H22BrN3O5S |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | (2R)-N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | Cc1oc(/C=N\NC(=O)[C@@H](C)N(c2ccc(Oc3ccccc3)cc2)S(C)(=O)=O)cc1Br |
| InChI | InChI=1S/C22H22BrN3O5S/c1-15(22(27)25-24-14-20-13-21(23)16(2)30-20)26(32(3,28)29)17-9-11-19(12-10-17)31-18-7-5-4-6-8-18/h4-15H,1-3H3,(H,25,27)/b24-14-/t15-/m1/s1 |
| InChIKey | ZZQCGZSTRXVDCH-CPISYKEBSA-N |
| XLogP | 4.45 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|