C22H29N3O4S — CID 126030024
(2R)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126030024) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (2R)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126030024 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (2R)-N-[(Z)-3,3-dimethylbutan-2-ylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C22H29N3O4S/c1-16(21(26)24-23-17(2)22(3,4)5)25(30(6,27)28)18-12-14-20(15-13-18)29-19-10-8-7-9-11-19/h7-16H,1-6H3,(H,24,26)/b23-17-/t16-/m1/s1 |
| InChIKey | XOZLTLZPNBSUHU-VKQKCINQSA-N |
| XLogP | 4.17 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|