C26H35N3O4S — CID 126033426
(2S)-N-[(4-tert-butylcyclohexylidene)amino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126033426) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is (2S)-N-[(4-tert-butylcyclohexylidene)amino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2S)-N-[(4-tert-butylcyclohexylidene)amino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126033426 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (2S)-N-[(4-tert-butylcyclohexylidene)amino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | C[C@@H](C(=O)NN=C1CCC(C(C)(C)C)CC1)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H35N3O4S/c1-19(25(30)28-27-21-13-11-20(12-14-21)26(2,3)4)29(34(5,31)32)22-15-17-24(18-16-22)33-23-9-7-6-8-10-23/h6-10,15-20H,11-14H2,1-5H3,(H,28,30)/b27-21-/t19-,20?/m0/s1 |
| InChIKey | KMZVRNMAUKIBMG-NMBMDGBASA-N |
| XLogP | 5.34 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|