C20H25N3O3S — CID 2856819
2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(2-methylpropylideneamino)acetamide (PubChem CID 2856819) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(2-methylpropylideneamino)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(2-methylpropylideneamino)acetamide |
|---|---|
| PubChem CID | 2856819 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(2-methylpropylideneamino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)NN=CC(C)C)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-15(2)13-21-22-20(24)14-23(19-11-10-16(3)12-17(19)4)27(25,26)18-8-6-5-7-9-18/h5-13,15H,14H2,1-4H3,(H,22,24) |
| InChIKey | MJXVKZKSWMTYRH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|