C20H25N3O3S — CID 2253626
N-(2,4-dimethylphenyl)-N-[2-[2-(2-methylprop-1-enyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide (PubChem CID 2253626) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N-[2-[2-(2-methylprop-1-enyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-N-[2-[2-(2-methylprop-1-enyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2253626 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N-[2-[2-(2-methylprop-1-enyl)hydrazinyl]-2-oxoethyl]benzenesulfonamide |
| SMILES | CC(C)=CNNC(=O)CN(c1ccc(C)cc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-15(2)13-21-22-20(24)14-23(19-11-10-16(3)12-17(19)4)27(25,26)18-8-6-5-7-9-18/h5-13,21H,14H2,1-4H3,(H,22,24) |
| InChIKey | IFIYOHJGUWDKAU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|