C24H24IN3O3S — CID 3656906
N-(2,4-dimethylphenyl)-N-[2-[2-[1-(3-iodophenyl)ethenyl]hydrazinyl]-2-oxoethyl]benzenesulfonamide (PubChem CID 3656906) has the molecular formula C24H24IN3O3S and a molecular weight of 561.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N-[2-[2-[1-(3-iodophenyl)ethenyl]hydrazinyl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-N-[2-[2-[1-(3-iodophenyl)ethenyl]hydrazinyl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3656906 |
| Molecular Formula | C24H24IN3O3S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N-[2-[2-[1-(3-iodophenyl)ethenyl]hydrazinyl]-2-oxoethyl]benzenesulfonamide |
| SMILES | C=C(NNC(=O)CN(c1ccc(C)cc1C)S(=O)(=O)c1ccccc1)c1cccc(I)c1 |
| InChI | InChI=1S/C24H24IN3O3S/c1-17-12-13-23(18(2)14-17)28(32(30,31)22-10-5-4-6-11-22)16-24(29)27-26-19(3)20-8-7-9-21(25)15-20/h4-15,26H,3,16H2,1-2H3,(H,27,29) |
| InChIKey | RTIGBLUFYUBPII-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|