C22H26N4O4S — CID 94837768
2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 94837768) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94837768 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(CSCC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26N4O4S/c1-16-9-17(2)11-18(10-16)14-31-15-22(27)24-23-13-19-12-20(26(28)29)3-4-21(19)25-5-7-30-8-6-25/h3-4,9-13H,5-8,14-15H2,1-2H3,(H,24,27)/b23-13- |
| InChIKey | DYWCQAWPHFTOSK-QRVIBDJDSA-N |
| XLogP | 3.43 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|