C20H17ClN4O5 — CID 126022068
5-chloro-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126022068) has the molecular formula C20H17ClN4O5 and a molecular weight of 428.83 g/mol. Its IUPAC name is 5-chloro-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126022068 |
| Molecular Formula | C20H17ClN4O5 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 5-chloro-N-[(Z)-(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])ccc1N1CCOCC1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C20H17ClN4O5/c21-15-1-4-18-13(9-15)11-19(30-18)20(26)23-22-12-14-10-16(25(27)28)2-3-17(14)24-5-7-29-8-6-24/h1-4,9-12H,5-8H2,(H,23,26)/b22-12- |
| InChIKey | NHMDXHQFQDNEJU-UUYOSTAYSA-N |
| XLogP | 3.59 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|