C30H26N4O6 — CID 101144179
CID 101144179 (PubChem CID 101144179) has the molecular formula C30H26N4O6 and a molecular weight of 538.56 g/mol.
| Compound Name | CID 101144179 |
|---|---|
| PubChem CID | 101144179 |
| Molecular Formula | C30H26N4O6 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2cccc([N+](=O)[O-])c2)[C@@]2(CCC/C(=C\c3cccc([N+](=O)[O-])c3)C2=O)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H26N4O6/c1-32-18-25(20-8-5-11-23(17-20)34(39)40)29(30(32)24-12-2-3-13-26(24)31-28(30)36)14-6-9-21(27(29)35)15-19-7-4-10-22(16-19)33(37)38/h2-5,7-8,10-13,15-17,25H,6,9,14,18H2,1H3,(H,31,36)/b21-15+/t25-,29+,30+/m0/s1 |
| InChIKey | OZSXGZLPKQGYAA-IBPAJAITSA-N |
| XLogP | 5.20 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|