C29H24BrN3O2 — CID 42599446
CID 42599446 (PubChem CID 42599446) has the molecular formula C29H24BrN3O2 and a molecular weight of 526.43 g/mol.
| Compound Name | CID 42599446 |
|---|---|
| PubChem CID | 42599446 |
| Molecular Formula | C29H24BrN3O2 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccc(Br)cc2)[C@@]2(CCc3c([nH]c4ccccc34)C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H24BrN3O2/c1-33-16-22(17-10-12-18(30)13-11-17)28(29(33)21-7-3-5-9-24(21)32-27(29)35)15-14-20-19-6-2-4-8-23(19)31-25(20)26(28)34/h2-13,22,31H,14-16H2,1H3,(H,32,35)/t22-,28+,29-/m0/s1 |
| InChIKey | WZUSVPSMRVLSNZ-GJDOKZOISA-N |
| XLogP | 5.62 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|