About CID 102309828
CID 102309828 (PubChem CID 102309828) has the molecular formula C30H21BrN2O3
and a molecular weight of 537.41 g/mol.
Molecular Properties
| Compound Name | CID 102309828 |
| PubChem CID | 102309828 |
| Molecular Formula | C30H21BrN2O3 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](C(=O)c2ccc(Br)cc2)[C@]2(C(=O)c3cccc4cccc2c34)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H21BrN2O3/c1-33-16-23(26(34)18-12-14-19(31)15-13-18)29(30(33)21-9-2-3-11-24(21)32-28(30)36)22-10-5-7-17-6-4-8-20(25(17)22)27(29)35/h2-15,23H,16H2,1H3,(H,32,36)/t23-,29+,30+/m0/s1 |
| InChIKey | VWRMHJCJYXVROS-NUZLPUNMSA-N |
| XLogP | 5.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 102309828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102309828?
The IUPAC name of CID 102309828 (CID 102309828) is not available.
What is the SMILES notation for CID 102309828?
The canonical SMILES for CID 102309828 is CN1C[C@@H](C(=O)c2ccc(Br)cc2)[C@]2(C(=O)c3cccc4cccc2c34)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 102309828?
The InChIKey is VWRMHJCJYXVROS-NUZLPUNMSA-N. The full InChI is InChI=1S/C30H21BrN2O3/c1-33-16-23(26(34)18-12-14-19(31)15-13-18)29(30(33)21-9-2-3-11-24(21)32-28(30)36)22-10-5-7-17-6-4-8-20(25(17)22)27(29)35/h2-15,23H,16H2,1H3,(H,32,36)/t23-,29+,30+/m0/s1.
What are the key properties of CID 102309828?
CID 102309828 has a molecular weight of 537.41 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102309828 is sourced from PubChem (CID 102309828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).