About CID 23636208
CID 23636208 (PubChem CID 23636208) has the molecular formula C28H22BrN3O3
and a molecular weight of 528.41 g/mol.
Molecular Properties
| Compound Name | CID 23636208 |
| PubChem CID | 23636208 |
| Molecular Formula | C28H22BrN3O3 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(Br)cc1)[C@@H]1[C@H]2CCCN2[C@]2(C(=O)Nc3ccccc32)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H22BrN3O3/c29-17-13-11-16(12-14-17)24(33)23-22-10-5-15-32(22)28(19-7-2-4-9-21(19)31-26(28)35)27(23)18-6-1-3-8-20(18)30-25(27)34/h1-4,6-9,11-14,22-23H,5,10,15H2,(H,30,34)(H,31,35)/t22-,23+,27-,28-/m1/s1 |
| InChIKey | GTIUKINFONWQJL-ATRCONBKSA-N |
| XLogP | 4.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 23636208 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23636208?
The IUPAC name of CID 23636208 (CID 23636208) is not available.
What is the SMILES notation for CID 23636208?
The canonical SMILES for CID 23636208 is O=C(c1ccc(Br)cc1)[C@@H]1[C@H]2CCCN2[C@]2(C(=O)Nc3ccccc32)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 23636208?
The InChIKey is GTIUKINFONWQJL-ATRCONBKSA-N. The full InChI is InChI=1S/C28H22BrN3O3/c29-17-13-11-16(12-14-17)24(33)23-22-10-5-15-32(22)28(19-7-2-4-9-21(19)31-26(28)35)27(23)18-6-1-3-8-20(18)30-25(27)34/h1-4,6-9,11-14,22-23H,5,10,15H2,(H,30,34)(H,31,35)/t22-,23+,27-,28-/m1/s1.
What are the key properties of CID 23636208?
CID 23636208 has a molecular weight of 528.41 g/mol, XLogP of 4.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23636208 is sourced from PubChem (CID 23636208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).