About CID 98165810
CID 98165810 (PubChem CID 98165810) has the molecular formula C28H21BrClN3O3
and a molecular weight of 562.85 g/mol.
Molecular Properties
| Compound Name | CID 98165810 |
| PubChem CID | 98165810 |
| Molecular Formula | C28H21BrClN3O3 |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(Br)cc1)[C@H]1[C@@H]2CCCN2[C@]2(C(=O)Nc3c(Cl)cccc32)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H21BrClN3O3/c29-16-12-10-15(11-13-16)24(34)22-21-9-4-14-33(21)28(18-6-3-7-19(30)23(18)32-26(28)36)27(22)17-5-1-2-8-20(17)31-25(27)35/h1-3,5-8,10-13,21-22H,4,9,14H2,(H,31,35)(H,32,36)/t21-,22+,27+,28+/m0/s1 |
| InChIKey | ZGKAYFNNHKDJHQ-ZMRCCQFYSA-N |
| XLogP | 5.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 98165810 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98165810?
The IUPAC name of CID 98165810 (CID 98165810) is not available.
What is the SMILES notation for CID 98165810?
The canonical SMILES for CID 98165810 is O=C(c1ccc(Br)cc1)[C@H]1[C@@H]2CCCN2[C@]2(C(=O)Nc3c(Cl)cccc32)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 98165810?
The InChIKey is ZGKAYFNNHKDJHQ-ZMRCCQFYSA-N. The full InChI is InChI=1S/C28H21BrClN3O3/c29-16-12-10-15(11-13-16)24(34)22-21-9-4-14-33(21)28(18-6-3-7-19(30)23(18)32-26(28)36)27(22)17-5-1-2-8-20(17)31-25(27)35/h1-3,5-8,10-13,21-22H,4,9,14H2,(H,31,35)(H,32,36)/t21-,22+,27+,28+/m0/s1.
What are the key properties of CID 98165810?
CID 98165810 has a molecular weight of 562.85 g/mol, XLogP of 5.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98165810 is sourced from PubChem (CID 98165810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).