About CID 98302657
CID 98302657 (PubChem CID 98302657) has the molecular formula C32H30ClN3O4
and a molecular weight of 556.06 g/mol.
Molecular Properties
| Compound Name | CID 98302657 |
| PubChem CID | 98302657 |
| Molecular Formula | C32H30ClN3O4 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cl)c2c(c1)[C@@]1(C(=O)N2)N2CCC[C@@H]2[C@@H](C(=O)c2ccc(OC(C)C)cc2)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H30ClN3O4/c1-17(2)40-20-12-10-19(11-13-20)28(37)26-25-9-6-14-36(25)32(22-15-18(3)16-23(33)27(22)35-30(32)39)31(26)21-7-4-5-8-24(21)34-29(31)38/h4-5,7-8,10-13,15-17,25-26H,6,9,14H2,1-3H3,(H,34,38)(H,35,39)/t25-,26+,31-,32+/m1/s1 |
| InChIKey | YEKWPWNFSXDCDC-ALIQNMSOSA-N |
| XLogP | 5.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 98302657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98302657?
The IUPAC name of CID 98302657 (CID 98302657) is not available.
What is the SMILES notation for CID 98302657?
The canonical SMILES for CID 98302657 is Cc1cc(Cl)c2c(c1)[C@@]1(C(=O)N2)N2CCC[C@@H]2[C@@H](C(=O)c2ccc(OC(C)C)cc2)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 98302657?
The InChIKey is YEKWPWNFSXDCDC-ALIQNMSOSA-N. The full InChI is InChI=1S/C32H30ClN3O4/c1-17(2)40-20-12-10-19(11-13-20)28(37)26-25-9-6-14-36(25)32(22-15-18(3)16-23(33)27(22)35-30(32)39)31(26)21-7-4-5-8-24(21)34-29(31)38/h4-5,7-8,10-13,15-17,25-26H,6,9,14H2,1-3H3,(H,34,38)(H,35,39)/t25-,26+,31-,32+/m1/s1.
What are the key properties of CID 98302657?
CID 98302657 has a molecular weight of 556.06 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98302657 is sourced from PubChem (CID 98302657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).