About CID 98363394
CID 98363394 (PubChem CID 98363394) has the molecular formula C32H24ClN3O3
and a molecular weight of 534.02 g/mol.
Molecular Properties
| Compound Name | CID 98363394 |
| PubChem CID | 98363394 |
| Molecular Formula | C32H24ClN3O3 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc2ccccc2c1)[C@@H]1[C@H]2CCCN2[C@]2(C(=O)Nc3c(Cl)cccc32)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H24ClN3O3/c33-23-11-5-10-22-27(23)35-30(39)32(22)31(21-9-3-4-12-24(21)34-29(31)38)26(25-13-6-16-36(25)32)28(37)20-15-14-18-7-1-2-8-19(18)17-20/h1-5,7-12,14-15,17,25-26H,6,13,16H2,(H,34,38)(H,35,39)/t25-,26+,31+,32-/m1/s1 |
| InChIKey | FDBJOTRTGIYKHF-SGDGVZKBSA-N |
| XLogP | 5.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 98363394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98363394?
The IUPAC name of CID 98363394 (CID 98363394) is not available.
What is the SMILES notation for CID 98363394?
The canonical SMILES for CID 98363394 is O=C(c1ccc2ccccc2c1)[C@@H]1[C@H]2CCCN2[C@]2(C(=O)Nc3c(Cl)cccc32)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 98363394?
The InChIKey is FDBJOTRTGIYKHF-SGDGVZKBSA-N. The full InChI is InChI=1S/C32H24ClN3O3/c33-23-11-5-10-22-27(23)35-30(39)32(22)31(21-9-3-4-12-24(21)34-29(31)38)26(25-13-6-16-36(25)32)28(37)20-15-14-18-7-1-2-8-19(18)17-20/h1-5,7-12,14-15,17,25-26H,6,13,16H2,(H,34,38)(H,35,39)/t25-,26+,31+,32-/m1/s1.
What are the key properties of CID 98363394?
CID 98363394 has a molecular weight of 534.02 g/mol, XLogP of 5.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98363394 is sourced from PubChem (CID 98363394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).