About CID 40916467
CID 40916467 (PubChem CID 40916467) has the molecular formula C30H27N3O4
and a molecular weight of 493.56 g/mol.
Molecular Properties
| Compound Name | CID 40916467 |
| PubChem CID | 40916467 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | — |
| SMILES | COc1cccc(C(=O)[C@@H]2[C@H]3CCCN3[C@]3(C(=O)Nc4c(C)cccc43)[C@]23C(=O)Nc2ccccc23)c1 |
| InChI | InChI=1S/C30H27N3O4/c1-17-8-5-12-21-25(17)32-28(36)30(21)29(20-11-3-4-13-22(20)31-27(29)35)24(23-14-7-15-33(23)30)26(34)18-9-6-10-19(16-18)37-2/h3-6,8-13,16,23-24H,7,14-15H2,1-2H3,(H,31,35)(H,32,36)/t23-,24+,29+,30-/m1/s1 |
| InChIKey | GFPWAQIHWBGSEM-LZEUDMGESA-N |
| XLogP | 4.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 40916467 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 40916467?
The IUPAC name of CID 40916467 (CID 40916467) is not available.
What is the SMILES notation for CID 40916467?
The canonical SMILES for CID 40916467 is COc1cccc(C(=O)[C@@H]2[C@H]3CCCN3[C@]3(C(=O)Nc4c(C)cccc43)[C@]23C(=O)Nc2ccccc23)c1.
What is the InChIKey of CID 40916467?
The InChIKey is GFPWAQIHWBGSEM-LZEUDMGESA-N. The full InChI is InChI=1S/C30H27N3O4/c1-17-8-5-12-21-25(17)32-28(36)30(21)29(20-11-3-4-13-22(20)31-27(29)35)24(23-14-7-15-33(23)30)26(34)18-9-6-10-19(16-18)37-2/h3-6,8-13,16,23-24H,7,14-15H2,1-2H3,(H,31,35)(H,32,36)/t23-,24+,29+,30-/m1/s1.
What are the key properties of CID 40916467?
CID 40916467 has a molecular weight of 493.56 g/mol, XLogP of 4.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 40916467 is sourced from PubChem (CID 40916467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).