About CID 51704588
CID 51704588 (PubChem CID 51704588) has the molecular formula C30H27N3O3
and a molecular weight of 477.56 g/mol.
Molecular Properties
| Compound Name | CID 51704588 |
| PubChem CID | 51704588 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | — |
| SMILES | CCc1cccc2c1NC(=O)[C@@]21N2CCC[C@@H]2[C@@H](C(=O)c2ccccc2)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H27N3O3/c1-2-18-12-8-14-21-25(18)32-28(36)30(21)29(20-13-6-7-15-22(20)31-27(29)35)24(23-16-9-17-33(23)30)26(34)19-10-4-3-5-11-19/h3-8,10-15,23-24H,2,9,16-17H2,1H3,(H,31,35)(H,32,36)/t23-,24+,29-,30+/m1/s1 |
| InChIKey | MERVUSSRRGAVCO-SMVSGJMUSA-N |
| XLogP | 4.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 51704588 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 51704588?
The IUPAC name of CID 51704588 (CID 51704588) is not available.
What is the SMILES notation for CID 51704588?
The canonical SMILES for CID 51704588 is CCc1cccc2c1NC(=O)[C@@]21N2CCC[C@@H]2[C@@H](C(=O)c2ccccc2)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 51704588?
The InChIKey is MERVUSSRRGAVCO-SMVSGJMUSA-N. The full InChI is InChI=1S/C30H27N3O3/c1-2-18-12-8-14-21-25(18)32-28(36)30(21)29(20-13-6-7-15-22(20)31-27(29)35)24(23-16-9-17-33(23)30)26(34)19-10-4-3-5-11-19/h3-8,10-15,23-24H,2,9,16-17H2,1H3,(H,31,35)(H,32,36)/t23-,24+,29-,30+/m1/s1.
What are the key properties of CID 51704588?
CID 51704588 has a molecular weight of 477.56 g/mol, XLogP of 4.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 51704588 is sourced from PubChem (CID 51704588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).