About CID 11729274
CID 11729274 (PubChem CID 11729274) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol.
Molecular Properties
| Compound Name | CID 11729274 |
| PubChem CID | 11729274 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(COc3ccccc3C2=O)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C26H22N2O3/c1-28-15-20(17-9-3-2-4-10-17)25(16-31-22-14-8-5-11-18(22)23(25)29)26(28)19-12-6-7-13-21(19)27-24(26)30/h2-14,20H,15-16H2,1H3,(H,27,30)/t20-,25+,26+/m0/s1 |
| InChIKey | QHOFUTURFHYTTR-GKBBYZSKSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11729274 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11729274?
The IUPAC name of CID 11729274 (CID 11729274) is not available.
What is the SMILES notation for CID 11729274?
The canonical SMILES for CID 11729274 is CN1C[C@@H](c2ccccc2)[C@@]2(COc3ccccc3C2=O)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 11729274?
The InChIKey is QHOFUTURFHYTTR-GKBBYZSKSA-N. The full InChI is InChI=1S/C26H22N2O3/c1-28-15-20(17-9-3-2-4-10-17)25(16-31-22-14-8-5-11-18(22)23(25)29)26(28)19-12-6-7-13-21(19)27-24(26)30/h2-14,20H,15-16H2,1H3,(H,27,30)/t20-,25+,26+/m0/s1.
What are the key properties of CID 11729274?
CID 11729274 has a molecular weight of 410.47 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11729274 is sourced from PubChem (CID 11729274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).