C26H22N2O3 — CID 11729274
CID 11729274 (PubChem CID 11729274) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol.
| Compound Name | CID 11729274 |
|---|---|
| PubChem CID | 11729274 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(COc3ccccc3C2=O)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C26H22N2O3/c1-28-15-20(17-9-3-2-4-10-17)25(16-31-22-14-8-5-11-18(22)23(25)29)26(28)19-12-6-7-13-21(19)27-24(26)30/h2-14,20H,15-16H2,1H3,(H,27,30)/t20-,25+,26+/m0/s1 |
| InChIKey | QHOFUTURFHYTTR-GKBBYZSKSA-N |
| XLogP | 3.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |