About CID 16742221
CID 16742221 (PubChem CID 16742221) has the molecular formula C30H20N2O5
and a molecular weight of 488.50 g/mol.
Molecular Properties
| Compound Name | CID 16742221 |
| PubChem CID | 16742221 |
| Molecular Formula | C30H20N2O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2cccc([N+](=O)[O-])c2)C2(C(=O)c3ccccc3C2=O)[C@]12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C30H20N2O5/c1-31-16-24(18-9-4-10-19(15-18)32(36)37)29(26(33)20-11-2-3-12-21(20)27(29)34)30(31)23-14-6-8-17-7-5-13-22(25(17)23)28(30)35/h2-15,24H,16H2,1H3/t24-,30-/m0/s1 |
| InChIKey | HYQQBVQRDSYAAI-NGQVCNFZSA-N |
| XLogP | 4.93 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 16742221 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16742221?
The IUPAC name of CID 16742221 (CID 16742221) is not available.
What is the SMILES notation for CID 16742221?
The canonical SMILES for CID 16742221 is CN1C[C@@H](c2cccc([N+](=O)[O-])c2)C2(C(=O)c3ccccc3C2=O)[C@]12C(=O)c1cccc3cccc2c13.
What is the InChIKey of CID 16742221?
The InChIKey is HYQQBVQRDSYAAI-NGQVCNFZSA-N. The full InChI is InChI=1S/C30H20N2O5/c1-31-16-24(18-9-4-10-19(15-18)32(36)37)29(26(33)20-11-2-3-12-21(20)27(29)34)30(31)23-14-6-8-17-7-5-13-22(25(17)23)28(30)35/h2-15,24H,16H2,1H3/t24-,30-/m0/s1.
What are the key properties of CID 16742221?
CID 16742221 has a molecular weight of 488.50 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16742221 is sourced from PubChem (CID 16742221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).