About CID 3394596
CID 3394596 (PubChem CID 3394596) has the molecular formula C29H26N4O4S2
and a molecular weight of 558.69 g/mol.
Molecular Properties
| Compound Name | CID 3394596 |
| PubChem CID | 3394596 |
| Molecular Formula | C29H26N4O4S2 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2C)N(C)CC(c2cccc([N+](=O)[O-])c2)C12SC(=S)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C29H26N4O4S2/c1-18-12-13-24-22(14-18)28(25(34)31(24)3)29(23(17-30(28)2)20-10-7-11-21(15-20)33(36)37)26(35)32(27(38)39-29)16-19-8-5-4-6-9-19/h4-15,23H,16-17H2,1-3H3 |
| InChIKey | SUMCUSGASDJPQG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 3394596 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 3394596?
The IUPAC name of CID 3394596 (CID 3394596) is not available.
What is the SMILES notation for CID 3394596?
The canonical SMILES for CID 3394596 is Cc1ccc2c(c1)C1(C(=O)N2C)N(C)CC(c2cccc([N+](=O)[O-])c2)C12SC(=S)N(Cc1ccccc1)C2=O.
What is the InChIKey of CID 3394596?
The InChIKey is SUMCUSGASDJPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26N4O4S2/c1-18-12-13-24-22(14-18)28(25(34)31(24)3)29(23(17-30(28)2)20-10-7-11-21(15-20)33(36)37)26(35)32(27(38)39-29)16-19-8-5-4-6-9-19/h4-15,23H,16-17H2,1-3H3.
What are the key properties of CID 3394596?
CID 3394596 has a molecular weight of 558.69 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 3394596 is sourced from PubChem (CID 3394596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).