C25H24FN3O3S2 — CID 100832438
CID 100832438 (PubChem CID 100832438) has the molecular formula C25H24FN3O3S2 and a molecular weight of 497.62 g/mol.
| Compound Name | CID 100832438 |
|---|---|
| PubChem CID | 100832438 |
| Molecular Formula | C25H24FN3O3S2 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | — |
| SMILES | C=CCN1C(=O)[C@]2(SC1=S)[C@H](c1cccc(OC)c1)CN(C)[C@]21C(=O)N(C)c2ccc(F)cc21 |
| InChI | InChI=1S/C25H24FN3O3S2/c1-5-11-29-22(31)25(34-23(29)33)19(15-7-6-8-17(12-15)32-4)14-27(2)24(25)18-13-16(26)9-10-20(18)28(3)21(24)30/h5-10,12-13,19H,1,11,14H2,2-4H3/t19-,24+,25+/m0/s1 |
| InChIKey | YQUCBZNVCRATCF-QTLGCAHFSA-N |
| XLogP | 3.52 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|