About CID 98184879
CID 98184879 (PubChem CID 98184879) has the molecular formula C29H33N3O6S2
and a molecular weight of 583.73 g/mol.
Molecular Properties
| Compound Name | CID 98184879 |
| PubChem CID | 98184879 |
| Molecular Formula | C29H33N3O6S2 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | — |
| SMILES | C=CCN1C(=O)[C@]2(SC1=S)[C@H](c1cc(OC)c(OC)c(OC)c1)CN(C)[C@@]21C(=O)N(C)c2ccc(OCC)cc21 |
| InChI | InChI=1S/C29H33N3O6S2/c1-8-12-32-26(34)29(40-27(32)39)20(17-13-22(35-5)24(37-7)23(14-17)36-6)16-30(3)28(29)19-15-18(38-9-2)10-11-21(19)31(4)25(28)33/h8,10-11,13-15,20H,1,9,12,16H2,2-7H3/t20-,28-,29+/m0/s1 |
| InChIKey | LBCRDIKURWARII-NNZIQWQDSA-N |
| XLogP | 3.80 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 98184879 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 98184879?
The IUPAC name of CID 98184879 (CID 98184879) is not available.
What is the SMILES notation for CID 98184879?
The canonical SMILES for CID 98184879 is C=CCN1C(=O)[C@]2(SC1=S)[C@H](c1cc(OC)c(OC)c(OC)c1)CN(C)[C@@]21C(=O)N(C)c2ccc(OCC)cc21.
What is the InChIKey of CID 98184879?
The InChIKey is LBCRDIKURWARII-NNZIQWQDSA-N. The full InChI is InChI=1S/C29H33N3O6S2/c1-8-12-32-26(34)29(40-27(32)39)20(17-13-22(35-5)24(37-7)23(14-17)36-6)16-30(3)28(29)19-15-18(38-9-2)10-11-21(19)31(4)25(28)33/h8,10-11,13-15,20H,1,9,12,16H2,2-7H3/t20-,28-,29+/m0/s1.
What are the key properties of CID 98184879?
CID 98184879 has a molecular weight of 583.73 g/mol, XLogP of 3.80, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 98184879 is sourced from PubChem (CID 98184879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).