About CID 99987051
CID 99987051 (PubChem CID 99987051) has the molecular formula C25H19FN4O5S2
and a molecular weight of 538.58 g/mol.
Molecular Properties
| Compound Name | CID 99987051 |
| PubChem CID | 99987051 |
| Molecular Formula | C25H19FN4O5S2 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2cccc([N+](=O)[O-])c2)[C@@]2(SC(=S)N(Cc3ccco3)C2=O)[C@@]12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C25H19FN4O5S2/c1-28-13-19(14-4-2-5-16(10-14)30(33)34)25(22(32)29(23(36)37-25)12-17-6-3-9-35-17)24(28)18-11-15(26)7-8-20(18)27-21(24)31/h2-11,19H,12-13H2,1H3,(H,27,31)/t19-,24-,25+/m1/s1 |
| InChIKey | DEGMUQLPHYVTCX-WVQWTBLQSA-N |
| XLogP | 4.00 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 99987051 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 99987051?
The IUPAC name of CID 99987051 (CID 99987051) is not available.
What is the SMILES notation for CID 99987051?
The canonical SMILES for CID 99987051 is CN1C[C@H](c2cccc([N+](=O)[O-])c2)[C@@]2(SC(=S)N(Cc3ccco3)C2=O)[C@@]12C(=O)Nc1ccc(F)cc12.
What is the InChIKey of CID 99987051?
The InChIKey is DEGMUQLPHYVTCX-WVQWTBLQSA-N. The full InChI is InChI=1S/C25H19FN4O5S2/c1-28-13-19(14-4-2-5-16(10-14)30(33)34)25(22(32)29(23(36)37-25)12-17-6-3-9-35-17)24(28)18-11-15(26)7-8-20(18)27-21(24)31/h2-11,19H,12-13H2,1H3,(H,27,31)/t19-,24-,25+/m1/s1.
What are the key properties of CID 99987051?
CID 99987051 has a molecular weight of 538.58 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 99987051 is sourced from PubChem (CID 99987051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).