About CID 7011703
CID 7011703 (PubChem CID 7011703) has the molecular formula C24H21N4O3S2+
and a molecular weight of 477.59 g/mol.
Molecular Properties
| Compound Name | CID 7011703 |
| PubChem CID | 7011703 |
| Molecular Formula | C24H21N4O3S2+ |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | — |
| SMILES | C[NH+]1C[C@H](c2ccccn2)[C@@]2(SC(=S)N(Cc3ccco3)C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H20N4O3S2/c1-27-14-17(18-9-4-5-11-25-18)24(23(27)16-8-2-3-10-19(16)26-20(23)29)21(30)28(22(32)33-24)13-15-7-6-12-31-15/h2-12,17H,13-14H2,1H3,(H,26,29)/p+1/t17-,23+,24+/m1/s1 |
| InChIKey | RNVQQSNUVRKHEQ-CQLNOVPUSA-O |
| XLogP | 1.93 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 7011703 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 7011703?
The IUPAC name of CID 7011703 (CID 7011703) is not available.
What is the SMILES notation for CID 7011703?
The canonical SMILES for CID 7011703 is C[NH+]1C[C@H](c2ccccn2)[C@@]2(SC(=S)N(Cc3ccco3)C2=O)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 7011703?
The InChIKey is RNVQQSNUVRKHEQ-CQLNOVPUSA-O. The full InChI is InChI=1S/C24H20N4O3S2/c1-27-14-17(18-9-4-5-11-25-18)24(23(27)16-8-2-3-10-19(16)26-20(23)29)21(30)28(22(32)33-24)13-15-7-6-12-31-15/h2-12,17H,13-14H2,1H3,(H,26,29)/p+1/t17-,23+,24+/m1/s1.
What are the key properties of CID 7011703?
CID 7011703 has a molecular weight of 477.59 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 7011703 is sourced from PubChem (CID 7011703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).