C28H26N4O2S2 — CID 4673959
CID 4673959 (PubChem CID 4673959) has the molecular formula C28H26N4O2S2 and a molecular weight of 514.68 g/mol.
| Compound Name | CID 4673959 |
|---|---|
| PubChem CID | 4673959 |
| Molecular Formula | C28H26N4O2S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | — |
| SMILES | CCc1ccc2c(c1)C1(C(=O)N2)N(C)CC(c2ccccn2)C12SC(=S)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C28H26N4O2S2/c1-3-18-12-13-23-20(15-18)27(24(33)30-23)28(21(17-31(27)2)22-11-7-8-14-29-22)25(34)32(26(35)36-28)16-19-9-5-4-6-10-19/h4-15,21H,3,16-17H2,1-2H3,(H,30,33) |
| InChIKey | GZGWLGMPBMBJNK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|