C33H26N2O2 — CID 139071231
1'-Methylacenapthylene-1(2H)-spiro-2'-pyrrolidine-3'-spiro-2''(3''H)-carbazole-2,1''(4''H)-dione (PubChem CID 139071231) has the molecular formula C33H26N2O2 and a molecular weight of 482.58 g/mol.
| Compound Name | 1'-Methylacenapthylene-1(2H)-spiro-2'-pyrrolidine-3'-spiro-2''(3''H)-carbazole-2,1''(4''H)-dione |
|---|---|
| PubChem CID | 139071231 |
| Molecular Formula | C33H26N2O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccccc2)[C@]2(CCc3c([nH]c4ccccc34)C2=O)[C@]12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C33H26N2O2/c1-35-19-26(20-9-3-2-4-10-20)32(18-17-23-22-13-5-6-16-27(22)34-29(23)31(32)37)33(35)25-15-8-12-21-11-7-14-24(28(21)25)30(33)36/h2-16,26,34H,17-19H2,1H3/t26-,32+,33+/m1/s1 |
| InChIKey | BREKGIWOIKWINL-DJDPXSJISA-N |
| XLogP | 6.26 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|