C31H22ClNO2 — CID 101429521
CID 101429521 (PubChem CID 101429521) has the molecular formula C31H22ClNO2 and a molecular weight of 475.98 g/mol.
| Compound Name | CID 101429521 |
|---|---|
| PubChem CID | 101429521 |
| Molecular Formula | C31H22ClNO2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2)C2(c3ccccc3-c3ccccc32)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H22ClNO2/c1-33-18-27(19-14-16-20(32)17-15-19)30(31(33)28(34)23-10-2-3-11-24(23)29(31)35)25-12-6-4-8-21(25)22-9-5-7-13-26(22)30/h2-17,27H,18H2,1H3/t27-/m1/s1 |
| InChIKey | MZMBGVVLQRINJP-HHHXNRCGSA-N |
| XLogP | 6.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|