About CID 101429521
CID 101429521 (PubChem CID 101429521) has the molecular formula C31H22ClNO2
and a molecular weight of 475.98 g/mol.
Molecular Properties
| Compound Name | CID 101429521 |
| PubChem CID | 101429521 |
| Molecular Formula | C31H22ClNO2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2)C2(c3ccccc3-c3ccccc32)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H22ClNO2/c1-33-18-27(19-14-16-20(32)17-15-19)30(31(33)28(34)23-10-2-3-11-24(23)29(31)35)25-12-6-4-8-21(25)22-9-5-7-13-26(22)30/h2-17,27H,18H2,1H3/t27-/m1/s1 |
| InChIKey | MZMBGVVLQRINJP-HHHXNRCGSA-N |
| XLogP | 6.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 101429521 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101429521?
The IUPAC name of CID 101429521 (CID 101429521) is not available.
What is the SMILES notation for CID 101429521?
The canonical SMILES for CID 101429521 is CN1C[C@H](c2ccc(Cl)cc2)C2(c3ccccc3-c3ccccc32)C12C(=O)c1ccccc1C2=O.
What is the InChIKey of CID 101429521?
The InChIKey is MZMBGVVLQRINJP-HHHXNRCGSA-N. The full InChI is InChI=1S/C31H22ClNO2/c1-33-18-27(19-14-16-20(32)17-15-19)30(31(33)28(34)23-10-2-3-11-24(23)29(31)35)25-12-6-4-8-21(25)22-9-5-7-13-26(22)30/h2-17,27H,18H2,1H3/t27-/m1/s1.
What are the key properties of CID 101429521?
CID 101429521 has a molecular weight of 475.98 g/mol, XLogP of 6.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101429521 is sourced from PubChem (CID 101429521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).