About CID 97464375
CID 97464375 (PubChem CID 97464375) has the molecular formula C26H20Cl2N2O3
and a molecular weight of 479.36 g/mol.
Molecular Properties
| Compound Name | CID 97464375 |
| PubChem CID | 97464375 |
| Molecular Formula | C26H20Cl2N2O3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccc(Cl)c(Cl)c2)[C@]2(COc3ccccc3C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C26H20Cl2N2O3/c1-30-13-18(15-10-11-19(27)20(28)12-15)25(14-33-22-9-5-2-6-16(22)23(25)31)26(30)17-7-3-4-8-21(17)29-24(26)32/h2-12,18H,13-14H2,1H3,(H,29,32)/t18-,25-,26-/m0/s1 |
| InChIKey | BTWLIFRLOVAGRN-ATANMQQVSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 97464375 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 97464375?
The IUPAC name of CID 97464375 (CID 97464375) is not available.
What is the SMILES notation for CID 97464375?
The canonical SMILES for CID 97464375 is CN1C[C@@H](c2ccc(Cl)c(Cl)c2)[C@]2(COc3ccccc3C2=O)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 97464375?
The InChIKey is BTWLIFRLOVAGRN-ATANMQQVSA-N. The full InChI is InChI=1S/C26H20Cl2N2O3/c1-30-13-18(15-10-11-19(27)20(28)12-15)25(14-33-22-9-5-2-6-16(22)23(25)31)26(30)17-7-3-4-8-21(17)29-24(26)32/h2-12,18H,13-14H2,1H3,(H,29,32)/t18-,25-,26-/m0/s1.
What are the key properties of CID 97464375?
CID 97464375 has a molecular weight of 479.36 g/mol, XLogP of 5.13, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 97464375 is sourced from PubChem (CID 97464375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).