C28H24ClN3O4 — CID 139226618
CID 139226618 (PubChem CID 139226618) has the molecular formula C28H24ClN3O4 and a molecular weight of 501.97 g/mol.
| Compound Name | CID 139226618 |
|---|---|
| PubChem CID | 139226618 |
| Molecular Formula | C28H24ClN3O4 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@H]2CN(C)[C@@]3(C(=O)Nc4ccccc43)[C@@]23CC(=O)N(c2ccc(Cl)cc2)C3=O)cc1 |
| InChI | InChI=1S/C28H24ClN3O4/c1-31-16-22(17-7-13-20(36-2)14-8-17)27(28(31)21-5-3-4-6-23(21)30-25(28)34)15-24(33)32(26(27)35)19-11-9-18(29)10-12-19/h3-14,22H,15-16H2,1-2H3,(H,30,34)/t22-,27+,28+/m1/s1 |
| InChIKey | WLUAJIUCUQRKFG-WWEDSPNTSA-N |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|