C28H25N3O5 — CID 139236338
CID 139236338 (PubChem CID 139236338) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol.
| Compound Name | CID 139236338 |
|---|---|
| PubChem CID | 139236338 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@H]2C3(CN(C)[C@@]24C(=O)Nc2ccccc24)C(=O)Nc2cc(OC)ccc2C3=O)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-31-15-27(24(32)19-13-12-18(36-3)14-22(19)30-25(27)33)23(16-8-10-17(35-2)11-9-16)28(31)20-6-4-5-7-21(20)29-26(28)34/h4-14,23H,15H2,1-3H3,(H,29,34)(H,30,33)/t23-,27?,28+/m0/s1 |
| InChIKey | WOOFDVCVFXEVPT-FNPAGISBSA-N |
| XLogP | 3.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|