C15H13NO4 — CID 15857499
3-hydroxy-3-(2-hydroxy-5-methoxyphenyl)-1H-indol-2-one (PubChem CID 15857499) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-hydroxy-3-(2-hydroxy-5-methoxyphenyl)-1H-indol-2-one.
| Compound Name | 3-hydroxy-3-(2-hydroxy-5-methoxyphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 15857499 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-hydroxy-3-(2-hydroxy-5-methoxyphenyl)-1H-indol-2-one |
| SMILES | COc1ccc(O)c(C2(O)C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C15H13NO4/c1-20-9-6-7-13(17)11(8-9)15(19)10-4-2-3-5-12(10)16-14(15)18/h2-8,17,19H,1H3,(H,16,18) |
| InChIKey | GJVWIMGCMCPRFH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |