C17H13IN2O3 — CID 118710079
3-hydroxy-5-iodo-3-(5-methoxy-1H-indol-3-yl)-1H-indol-2-one (PubChem CID 118710079) has the molecular formula C17H13IN2O3 and a molecular weight of 420.21 g/mol. Its IUPAC name is 3-hydroxy-5-iodo-3-(5-methoxy-1H-indol-3-yl)-1H-indol-2-one.
| Compound Name | 3-hydroxy-5-iodo-3-(5-methoxy-1H-indol-3-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 118710079 |
| Molecular Formula | C17H13IN2O3 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 3-hydroxy-5-iodo-3-(5-methoxy-1H-indol-3-yl)-1H-indol-2-one |
| SMILES | COc1ccc2[nH]cc(C3(O)C(=O)Nc4ccc(I)cc43)c2c1 |
| InChI | InChI=1S/C17H13IN2O3/c1-23-10-3-5-14-11(7-10)13(8-19-14)17(22)12-6-9(18)2-4-15(12)20-16(17)21/h2-8,19,22H,1H3,(H,20,21) |
| InChIKey | CTJUTNOSUMPPGS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|